C28H29ClN2O — CID 69065044
3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]-1-cyclopentylpropan-1-amine (PubChem CID 69065044) has the molecular formula C28H29ClN2O and a molecular weight of 445.01 g/mol. Its IUPAC name is 3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]-1-cyclopentylpropan-1-amine.
| Compound Name | 3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]-1-cyclopentylpropan-1-amine |
|---|---|
| PubChem CID | 69065044 |
| Molecular Formula | C28H29ClN2O |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]-1-cyclopentylpropan-1-amine |
| SMILES | Cc1cc(C#Cc2ccc(-c3ccc(Cl)cc3)cn2)ccc1OCCC(N)C1CCCC1 |
| InChI | InChI=1S/C28H29ClN2O/c1-20-18-21(7-15-28(20)32-17-16-27(30)23-4-2-3-5-23)6-13-26-14-10-24(19-31-26)22-8-11-25(29)12-9-22/h7-12,14-15,18-19,23,27H,2-5,16-17,30H2,1H3 |
| InChIKey | JOCHTFQDMNNBIK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|