C24H21ClN2 — CID 173162861
5-(4-chlorophenyl)-2-[2-[4-[[(2S)-pyrrolidin-2-yl]methyl]phenyl]ethynyl]pyridine (PubChem CID 173162861) has the molecular formula C24H21ClN2 and a molecular weight of 372.90 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[2-[4-[[(2S)-pyrrolidin-2-yl]methyl]phenyl]ethynyl]pyridine.
| Compound Name | 5-(4-chlorophenyl)-2-[2-[4-[[(2S)-pyrrolidin-2-yl]methyl]phenyl]ethynyl]pyridine |
|---|---|
| PubChem CID | 173162861 |
| Molecular Formula | C24H21ClN2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[2-[4-[[(2S)-pyrrolidin-2-yl]methyl]phenyl]ethynyl]pyridine |
| SMILES | Clc1ccc(-c2ccc(C#Cc3ccc(C[C@@H]4CCCN4)cc3)nc2)cc1 |
| InChI | InChI=1S/C24H21ClN2/c25-22-11-8-20(9-12-22)21-10-14-23(27-17-21)13-7-18-3-5-19(6-4-18)16-24-2-1-15-26-24/h3-6,8-12,14,17,24,26H,1-2,15-16H2/t24-/m0/s1 |
| InChIKey | RHEAWUOXHWSELA-DEOSSOPVSA-N |
| XLogP | 5.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|