C14H16ClN3 — CID 61366673
5-(4-chlorophenyl)-2-(pyrrolidin-2-ylmethyl)-1H-imidazole (PubChem CID 61366673) has the molecular formula C14H16ClN3 and a molecular weight of 261.76 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-(pyrrolidin-2-ylmethyl)-1H-imidazole.
| Compound Name | 5-(4-chlorophenyl)-2-(pyrrolidin-2-ylmethyl)-1H-imidazole |
|---|---|
| PubChem CID | 61366673 |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.76 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 5-(4-chlorophenyl)-2-(pyrrolidin-2-ylmethyl)-1H-imidazole |
| SMILES | Clc1ccc(-c2cnc(CC3CCCN3)[nH]2)cc1 |
| InChI | InChI=1S/C14H16ClN3/c15-11-5-3-10(4-6-11)13-9-17-14(18-13)8-12-2-1-7-16-12/h3-6,9,12,16H,1-2,7-8H2,(H,17,18) |
| InChIKey | SMTNIRDUMULRAD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |