C16H21N3O2 — CID 61364707
5-(2,5-dimethoxyphenyl)-2-(pyrrolidin-2-ylmethyl)-1H-imidazole (PubChem CID 61364707) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 5-(2,5-dimethoxyphenyl)-2-(pyrrolidin-2-ylmethyl)-1H-imidazole.
| Compound Name | 5-(2,5-dimethoxyphenyl)-2-(pyrrolidin-2-ylmethyl)-1H-imidazole |
|---|---|
| PubChem CID | 61364707 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 5-(2,5-dimethoxyphenyl)-2-(pyrrolidin-2-ylmethyl)-1H-imidazole |
| SMILES | COc1ccc(OC)c(-c2cnc(CC3CCCN3)[nH]2)c1 |
| InChI | InChI=1S/C16H21N3O2/c1-20-12-5-6-15(21-2)13(9-12)14-10-18-16(19-14)8-11-4-3-7-17-11/h5-6,9-11,17H,3-4,7-8H2,1-2H3,(H,18,19) |
| InChIKey | ZMNJDQABJQNQML-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |