C22H18ClNO — CID 69071295
[4-[4-[5-(4-chlorophenyl)-2-pyridinyl]but-3-ynyl]phenyl]methanol (PubChem CID 69071295) has the molecular formula C22H18ClNO and a molecular weight of 347.85 g/mol. Its IUPAC name is [4-[4-[5-(4-chlorophenyl)-2-pyridinyl]but-3-ynyl]phenyl]methanol.
| Compound Name | [4-[4-[5-(4-chlorophenyl)-2-pyridinyl]but-3-ynyl]phenyl]methanol |
|---|---|
| PubChem CID | 69071295 |
| Molecular Formula | C22H18ClNO |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | [4-[4-[5-(4-chlorophenyl)-2-pyridinyl]but-3-ynyl]phenyl]methanol |
| SMILES | OCc1ccc(CCC#Cc2ccc(-c3ccc(Cl)cc3)cn2)cc1 |
| InChI | InChI=1S/C22H18ClNO/c23-21-12-9-19(10-13-21)20-11-14-22(24-15-20)4-2-1-3-17-5-7-18(16-25)8-6-17/h5-15,25H,1,3,16H2 |
| InChIKey | AJOGELGDOGQNKV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|