C26H24Cl2N2 — CID 10342909
5-(3,4-dichlorophenyl)-2-[4-[4-(pyrrolidin-1-ylmethyl)phenyl]but-1-ynyl]pyridine (PubChem CID 10342909) has the molecular formula C26H24Cl2N2 and a molecular weight of 435.40 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-2-[4-[4-(pyrrolidin-1-ylmethyl)phenyl]but-1-ynyl]pyridine.
| Compound Name | 5-(3,4-dichlorophenyl)-2-[4-[4-(pyrrolidin-1-ylmethyl)phenyl]but-1-ynyl]pyridine |
|---|---|
| PubChem CID | 10342909 |
| Molecular Formula | C26H24Cl2N2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-2-[4-[4-(pyrrolidin-1-ylmethyl)phenyl]but-1-ynyl]pyridine |
| SMILES | Clc1ccc(-c2ccc(C#CCCc3ccc(CN4CCCC4)cc3)nc2)cc1Cl |
| InChI | InChI=1S/C26H24Cl2N2/c27-25-14-12-22(17-26(25)28)23-11-13-24(29-18-23)6-2-1-5-20-7-9-21(10-8-20)19-30-15-3-4-16-30/h7-14,17-18H,1,3-5,15-16,19H2 |
| InChIKey | KGBNDIATKQIRAO-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|