C26H25Cl2N3O3 — CID 67551380
4-(3,4-dichlorophenyl)-2-nitro-N-[2-[4-(pyrrolidin-1-ylmethyl)phenyl]ethyl]benzamide (PubChem CID 67551380) has the molecular formula C26H25Cl2N3O3 and a molecular weight of 498.41 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2-nitro-N-[2-[4-(pyrrolidin-1-ylmethyl)phenyl]ethyl]benzamide.
| Compound Name | 4-(3,4-dichlorophenyl)-2-nitro-N-[2-[4-(pyrrolidin-1-ylmethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 67551380 |
| Molecular Formula | C26H25Cl2N3O3 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2-nitro-N-[2-[4-(pyrrolidin-1-ylmethyl)phenyl]ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(CN2CCCC2)cc1)c1ccc(-c2ccc(Cl)c(Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H25Cl2N3O3/c27-23-10-8-20(15-24(23)28)21-7-9-22(25(16-21)31(33)34)26(32)29-12-11-18-3-5-19(6-4-18)17-30-13-1-2-14-30/h3-10,15-16H,1-2,11-14,17H2,(H,29,32) |
| InChIKey | JIJVOWSIGGDESK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|