C21H24IN3O3 — CID 60622884
N-[[4-(azepan-1-ylmethyl)phenyl]methyl]-2-iodo-4-nitrobenzamide (PubChem CID 60622884) has the molecular formula C21H24IN3O3 and a molecular weight of 493.35 g/mol. Its IUPAC name is N-[[4-(azepan-1-ylmethyl)phenyl]methyl]-2-iodo-4-nitrobenzamide.
| Compound Name | N-[[4-(azepan-1-ylmethyl)phenyl]methyl]-2-iodo-4-nitrobenzamide |
|---|---|
| PubChem CID | 60622884 |
| Molecular Formula | C21H24IN3O3 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N-[[4-(azepan-1-ylmethyl)phenyl]methyl]-2-iodo-4-nitrobenzamide |
| SMILES | O=C(NCc1ccc(CN2CCCCCC2)cc1)c1ccc([N+](=O)[O-])cc1I |
| InChI | InChI=1S/C21H24IN3O3/c22-20-13-18(25(27)28)9-10-19(20)21(26)23-14-16-5-7-17(8-6-16)15-24-11-3-1-2-4-12-24/h5-10,13H,1-4,11-12,14-15H2,(H,23,26) |
| InChIKey | PSVLRMNNZRYSLS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|