C23H21N5O — CID 87307595
8-oxido-12-[4-(piperidin-1-ylmethyl)phenyl]-5,10-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 87307595) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is 8-oxido-12-[4-(piperidin-1-ylmethyl)phenyl]-5,10-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 8-oxido-12-[4-(piperidin-1-ylmethyl)phenyl]-5,10-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 87307595 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 8-oxido-12-[4-(piperidin-1-ylmethyl)phenyl]-5,10-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[NH+]([O-])c1ncc(-c3ccc(CN4CCCCC4)cc3)cc1-2 |
| InChI | InChI=1S/C23H21N5O/c24-12-19-11-20-21-10-18(13-26-23(21)28(29)22(20)14-25-19)17-6-4-16(5-7-17)15-27-8-2-1-3-9-27/h4-7,10-11,13-14,28H,1-3,8-9,15H2 |
| InChIKey | RQPUNBCMGZLOQS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |