C23H20ClNO4S — CID 91287879
3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]-2-methylpropane-1-sulfonic acid (PubChem CID 91287879) has the molecular formula C23H20ClNO4S and a molecular weight of 441.94 g/mol. Its IUPAC name is 3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]-2-methylpropane-1-sulfonic acid.
| Compound Name | 3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 91287879 |
| Molecular Formula | C23H20ClNO4S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]-2-methylpropane-1-sulfonic acid |
| SMILES | CC(COc1ccc(C#Cc2ccc(-c3ccc(Cl)cc3)cn2)cc1)CS(=O)(=O)O |
| InChI | InChI=1S/C23H20ClNO4S/c1-17(16-30(26,27)28)15-29-23-12-3-18(4-13-23)2-10-22-11-7-20(14-25-22)19-5-8-21(24)9-6-19/h3-9,11-14,17H,15-16H2,1H3,(H,26,27,28) |
| InChIKey | RXNKSQMTYBHMKX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|