C8H7Cl2N3O — CID 61397043
4-(2-azidoethoxy)-1,2-dichlorobenzene (PubChem CID 61397043) has the molecular formula C8H7Cl2N3O and a molecular weight of 232.07 g/mol. Its IUPAC name is 4-(2-azidoethoxy)-1,2-dichlorobenzene.
| Compound Name | 4-(2-azidoethoxy)-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 61397043 |
| Molecular Formula | C8H7Cl2N3O |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 4-(2-azidoethoxy)-1,2-dichlorobenzene |
| SMILES | [N-]=[N+]=NCCOc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2N3O/c9-7-2-1-6(5-8(7)10)14-4-3-12-13-11/h1-2,5H,3-4H2 |
| InChIKey | OLNNGLDVTQOTLZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|