About bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+)
bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+) (PubChem CID 23326300) has the molecular formula C16H16Br2NiO8S4
and a molecular weight of 683.07 g/mol. Its IUPAC name is bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+).
Molecular Properties
| Compound Name | bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+) |
| PubChem CID | 23326300 |
| Molecular Formula | C16H16Br2NiO8S4 |
| Molecular Weight | 683.07 g/mol |
| Exact Mass | 679.74 |
| IUPAC Name | bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+) |
| SMILES | O=S([O-])(=S)OCCOc1ccc(Br)cc1.O=S([O-])(=S)OCCOc1ccc(Br)cc1.[Ni+2] |
| InChI | InChI=1S/2C8H9BrO4S2.Ni/c2*9-7-1-3-8(4-2-7)12-5-6-13-15(10,11)14;/h2*1-4H,5-6H2,(H,10,11,14);/q;;+2/p-2 |
| InChIKey | WLYLTROTOGHALV-UHFFFAOYSA-L |
| XLogP | 3.27 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 683.07 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+)?
The IUPAC name of bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+) (CID 23326300) is bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+).
What is the SMILES notation for bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+)?
The canonical SMILES for bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+) is O=S([O-])(=S)OCCOc1ccc(Br)cc1.O=S([O-])(=S)OCCOc1ccc(Br)cc1.[Ni+2].
What is the InChIKey of bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+)?
The InChIKey is WLYLTROTOGHALV-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H9BrO4S2.Ni/c2*9-7-1-3-8(4-2-7)12-5-6-13-15(10,11)14;/h2*1-4H,5-6H2,(H,10,11,14);/q;;+2/p-2.
What are the key properties of bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+)?
bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+) has a molecular weight of 683.07 g/mol, XLogP of 3.27, 10 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-(4-bromophenoxy)ethoxy-oxido-oxo-sulfanylidene-λ6-sulfane);nickel(2+) is sourced from PubChem (CID 23326300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).