C31H35F2O7S2+ — CID 147961249
1,1-difluoro-2-[4-[2-(2-methylbutan-2-yl)-5-[2-methyl-2-(1,4-oxathian-4-ium-4-yl)propanoyl]phenyl]naphthalen-2-yl]oxy-2-oxoethanesulfonic acid (PubChem CID 147961249) has the molecular formula C31H35F2O7S2+ and a molecular weight of 621.74 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-[2-(2-methylbutan-2-yl)-5-[2-methyl-2-(1,4-oxathian-4-ium-4-yl)propanoyl]phenyl]naphthalen-2-yl]oxy-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[4-[2-(2-methylbutan-2-yl)-5-[2-methyl-2-(1,4-oxathian-4-ium-4-yl)propanoyl]phenyl]naphthalen-2-yl]oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 147961249 |
| Molecular Formula | C31H35F2O7S2+ |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.18 |
| IUPAC Name | 1,1-difluoro-2-[4-[2-(2-methylbutan-2-yl)-5-[2-methyl-2-(1,4-oxathian-4-ium-4-yl)propanoyl]phenyl]naphthalen-2-yl]oxy-2-oxoethanesulfonic acid |
| SMILES | CCC(C)(C)c1ccc(C(=O)C(C)(C)[S+]2CCOCC2)cc1-c1cc(OC(=O)C(F)(F)S(=O)(=O)O)cc2ccccc12 |
| InChI | InChI=1S/C31H34F2O7S2/c1-6-29(2,3)26-12-11-21(27(34)30(4,5)41-15-13-39-14-16-41)18-25(26)24-19-22(17-20-9-7-8-10-23(20)24)40-28(35)31(32,33)42(36,37)38/h7-12,17-19H,6,13-16H2,1-5H3/p+1 |
| InChIKey | IPNMRBURWWLYBM-UHFFFAOYSA-O |
| XLogP | 6.19 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|