C25H26F2O5S — CID 163297782
[5-(benzenesulfonyl)-5,5-difluoropentyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 163297782) has the molecular formula C25H26F2O5S and a molecular weight of 476.54 g/mol. Its IUPAC name is [5-(benzenesulfonyl)-5,5-difluoropentyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | [5-(benzenesulfonyl)-5,5-difluoropentyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 163297782 |
| Molecular Formula | C25H26F2O5S |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | [5-(benzenesulfonyl)-5,5-difluoropentyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)OCCCCC(F)(F)S(=O)(=O)c3ccccc3)ccc2c1 |
| InChI | InChI=1S/C25H26F2O5S/c1-18(19-10-11-21-17-22(31-2)13-12-20(21)16-19)24(28)32-15-7-6-14-25(26,27)33(29,30)23-8-4-3-5-9-23/h3-5,8-13,16-18H,6-7,14-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | AQQSGKSJUHZHLI-SFHVURJKSA-N |
| XLogP | 5.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|