C39H40F2O5S — CID 163297716
[5-(benzenesulfonyl)-5,5-difluoropentyl] 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate (PubChem CID 163297716) has the molecular formula C39H40F2O5S and a molecular weight of 658.81 g/mol. Its IUPAC name is [5-(benzenesulfonyl)-5,5-difluoropentyl] 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate.
| Compound Name | [5-(benzenesulfonyl)-5,5-difluoropentyl] 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 163297716 |
| Molecular Formula | C39H40F2O5S |
| Molecular Weight | 658.81 g/mol |
| Exact Mass | 658.26 |
| IUPAC Name | [5-(benzenesulfonyl)-5,5-difluoropentyl] 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate |
| SMILES | COc1ccc(-c2ccc3cc(C(=O)OCCCCC(F)(F)S(=O)(=O)c4ccccc4)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C39H40F2O5S/c1-45-36-14-13-32(22-35(36)38-23-26-17-27(24-38)19-28(18-26)25-38)30-9-10-31-21-33(12-11-29(31)20-30)37(42)46-16-6-5-15-39(40,41)47(43,44)34-7-3-2-4-8-34/h2-4,7-14,20-22,26-28H,5-6,15-19,23-25H2,1H3 |
| InChIKey | ACFRCFASSYPUDA-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.81 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|