C24H15F6O6S2Se- — CID 138981063
3-[2,2-bis(trifluoromethylsulfonyl)ethyl]-2-(6-methoxynaphthalen-2-yl)selenochromen-4-one (PubChem CID 138981063) has the molecular formula C24H15F6O6S2Se- and a molecular weight of 656.46 g/mol. Its IUPAC name is 3-[2,2-bis(trifluoromethylsulfonyl)ethyl]-2-(6-methoxynaphthalen-2-yl)selenochromen-4-one.
| Compound Name | 3-[2,2-bis(trifluoromethylsulfonyl)ethyl]-2-(6-methoxynaphthalen-2-yl)selenochromen-4-one |
|---|---|
| PubChem CID | 138981063 |
| Molecular Formula | C24H15F6O6S2Se- |
| Molecular Weight | 656.46 g/mol |
| Exact Mass | 656.94 |
| IUPAC Name | 3-[2,2-bis(trifluoromethylsulfonyl)ethyl]-2-(6-methoxynaphthalen-2-yl)selenochromen-4-one |
| SMILES | COc1ccc2cc(-c3[se]c4ccccc4c(=O)c3C[C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C24H15F6O6S2Se/c1-36-16-9-8-13-10-15(7-6-14(13)11-16)22-18(21(31)17-4-2-3-5-19(17)39-22)12-20(37(32,33)23(25,26)27)38(34,35)24(28,29)30/h2-11H,12H2,1H3/q-1 |
| InChIKey | XMVZFTOTDFQCJA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|