C20H13F6O6S2Se- — CID 154713857
3-[2,2-bis(trifluoromethylsulfonyl)ethyl]-2-(4-methoxyphenyl)selenochromen-4-one (PubChem CID 154713857) has the molecular formula C20H13F6O6S2Se- and a molecular weight of 606.40 g/mol. Its IUPAC name is 3-[2,2-bis(trifluoromethylsulfonyl)ethyl]-2-(4-methoxyphenyl)selenochromen-4-one.
| Compound Name | 3-[2,2-bis(trifluoromethylsulfonyl)ethyl]-2-(4-methoxyphenyl)selenochromen-4-one |
|---|---|
| PubChem CID | 154713857 |
| Molecular Formula | C20H13F6O6S2Se- |
| Molecular Weight | 606.40 g/mol |
| Exact Mass | 606.92 |
| IUPAC Name | 3-[2,2-bis(trifluoromethylsulfonyl)ethyl]-2-(4-methoxyphenyl)selenochromen-4-one |
| SMILES | COc1ccc(-c2[se]c3ccccc3c(=O)c2C[C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H13F6O6S2Se/c1-32-12-8-6-11(7-9-12)18-14(17(27)13-4-2-3-5-15(13)35-18)10-16(33(28,29)19(21,22)23)34(30,31)20(24,25)26/h2-9H,10H2,1H3/q-1 |
| InChIKey | NJDFHUBBXBXEOL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|