C38H49F5O5S3 — CID 56628149
[4-[1-formyl-2-methyl-6-(2-methylsulfanylacetyl)oxy-1-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-3,4-dihydronaphthalen-2-yl]phenyl] 2-methylsulfanylacetate (PubChem CID 56628149) has the molecular formula C38H49F5O5S3 and a molecular weight of 777.00 g/mol. Its IUPAC name is [4-[1-formyl-2-methyl-6-(2-methylsulfanylacetyl)oxy-1-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-3,4-dihydronaphthalen-2-yl]phenyl] 2-methylsulfanylacetate.
| Compound Name | [4-[1-formyl-2-methyl-6-(2-methylsulfanylacetyl)oxy-1-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-3,4-dihydronaphthalen-2-yl]phenyl] 2-methylsulfanylacetate |
|---|---|
| PubChem CID | 56628149 |
| Molecular Formula | C38H49F5O5S3 |
| Molecular Weight | 777.00 g/mol |
| Exact Mass | 776.27 |
| IUPAC Name | [4-[1-formyl-2-methyl-6-(2-methylsulfanylacetyl)oxy-1-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-3,4-dihydronaphthalen-2-yl]phenyl] 2-methylsulfanylacetate |
| SMILES | CSCC(=O)Oc1ccc(C2(C)CCc3cc(OC(=O)CSC)ccc3C2(C=O)CCCCCCCCCSCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C38H49F5O5S3/c1-35(29-12-14-30(15-13-29)47-33(45)25-49-2)21-18-28-24-31(48-34(46)26-50-3)16-17-32(28)36(35,27-44)19-9-7-5-4-6-8-10-22-51-23-11-20-37(39,40)38(41,42)43/h12-17,24,27H,4-11,18-23,25-26H2,1-3H3 |
| InChIKey | HIAIFTSRPXTBQR-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.00 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|