C15H14F9N2O7S3- — CID 59302261
[1,1,2,2,3,3-hexafluoro-3-(4-piperidin-1-ylphenoxy)sulfonylpropyl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 59302261) has the molecular formula C15H14F9N2O7S3- and a molecular weight of 601.47 g/mol. Its IUPAC name is [1,1,2,2,3,3-hexafluoro-3-(4-piperidin-1-ylphenoxy)sulfonylpropyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [1,1,2,2,3,3-hexafluoro-3-(4-piperidin-1-ylphenoxy)sulfonylpropyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 59302261 |
| Molecular Formula | C15H14F9N2O7S3- |
| Molecular Weight | 601.47 g/mol |
| Exact Mass | 600.98 |
| IUPAC Name | [1,1,2,2,3,3-hexafluoro-3-(4-piperidin-1-ylphenoxy)sulfonylpropyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)Oc1ccc(N2CCCCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H14F9N2O7S3/c16-12(17,13(18,19)34(27,28)25-35(29,30)15(22,23)24)14(20,21)36(31,32)33-11-6-4-10(5-7-11)26-8-2-1-3-9-26/h4-7H,1-3,8-9H2/q-1 |
| InChIKey | PCOAOLGSMCHLDS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 128.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|