C19H29O2S+ — CID 140741704
2-methyl-1-[4-(2-methylbutan-2-yl)phenyl]-2-(1,4-oxathian-4-ium-4-yl)propan-1-one (PubChem CID 140741704) has the molecular formula C19H29O2S+ and a molecular weight of 321.51 g/mol. Its IUPAC name is 2-methyl-1-[4-(2-methylbutan-2-yl)phenyl]-2-(1,4-oxathian-4-ium-4-yl)propan-1-one.
| Compound Name | 2-methyl-1-[4-(2-methylbutan-2-yl)phenyl]-2-(1,4-oxathian-4-ium-4-yl)propan-1-one |
|---|---|
| PubChem CID | 140741704 |
| Molecular Formula | C19H29O2S+ |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-methyl-1-[4-(2-methylbutan-2-yl)phenyl]-2-(1,4-oxathian-4-ium-4-yl)propan-1-one |
| SMILES | CCC(C)(C)c1ccc(C(=O)C(C)(C)[S+]2CCOCC2)cc1 |
| InChI | InChI=1S/C19H29O2S/c1-6-18(2,3)16-9-7-15(8-10-16)17(20)19(4,5)22-13-11-21-12-14-22/h7-10H,6,11-14H2,1-5H3/q+1 |
| InChIKey | AHZZAIVHSMCHGG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|