C18H26N2O5 — CID 118151584
tert-butyl [4-[N'-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]phenyl] carbonate (PubChem CID 118151584) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is tert-butyl [4-[N'-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]phenyl] carbonate.
| Compound Name | tert-butyl [4-[N'-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 118151584 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | tert-butyl [4-[N'-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]phenyl] carbonate |
| SMILES | C/N=C(\NC(=O)OC(C)(C)C)c1ccc(OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H26N2O5/c1-17(2,3)24-15(21)20-14(19-7)12-8-10-13(11-9-12)23-16(22)25-18(4,5)6/h8-11H,1-7H3,(H,19,20,21) |
| InChIKey | BPPZBZXUPUYACY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|