About 2-oxopropyl 2-bromo-2-phenylacetate
2-oxopropyl 2-bromo-2-phenylacetate (PubChem CID 102432807) has the molecular formula C11H11BrO3
and a molecular weight of 271.11 g/mol. Its IUPAC name is 2-oxopropyl 2-bromo-2-phenylacetate.
Molecular Properties
| Compound Name | 2-oxopropyl 2-bromo-2-phenylacetate |
| PubChem CID | 102432807 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 2-oxopropyl 2-bromo-2-phenylacetate |
| SMILES | CC(=O)COC(=O)C(Br)c1ccccc1 |
| InChI | InChI=1S/C11H11BrO3/c1-8(13)7-15-11(14)10(12)9-5-3-2-4-6-9/h2-6,10H,7H2,1H3 |
| InChIKey | VVIUIXYHPPPXQY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropyl 2-bromo-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl 2-bromo-2-phenylacetate?
The IUPAC name of 2-oxopropyl 2-bromo-2-phenylacetate (CID 102432807) is 2-oxopropyl 2-bromo-2-phenylacetate.
What is the SMILES notation for 2-oxopropyl 2-bromo-2-phenylacetate?
The canonical SMILES for 2-oxopropyl 2-bromo-2-phenylacetate is CC(=O)COC(=O)C(Br)c1ccccc1.
What is the InChIKey of 2-oxopropyl 2-bromo-2-phenylacetate?
The InChIKey is VVIUIXYHPPPXQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO3/c1-8(13)7-15-11(14)10(12)9-5-3-2-4-6-9/h2-6,10H,7H2,1H3.
What are the key properties of 2-oxopropyl 2-bromo-2-phenylacetate?
2-oxopropyl 2-bromo-2-phenylacetate has a molecular weight of 271.11 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl 2-bromo-2-phenylacetate is sourced from PubChem (CID 102432807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).