C25H24P+ — CID 144583668
[(2E)-2-ethenylpenta-2,4-dienyl]-triphenylphosphanium (PubChem CID 144583668) has the molecular formula C25H24P+ and a molecular weight of 355.44 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl]-triphenylphosphanium.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 144583668 |
| Molecular Formula | C25H24P+ |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl]-triphenylphosphanium |
| SMILES | C=C/C=C(\C=C)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24P/c1-3-14-22(4-2)21-26(23-15-8-5-9-16-23,24-17-10-6-11-18-24)25-19-12-7-13-20-25/h3-20H,1-2,21H2/q+1/b22-14+ |
| InChIKey | SSUPHUWZQDWYRB-HYARGMPZSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|