C22H34N2S — CID 144921266
N-[2-[[(6Z)-2,6-bis(ethenyl)nona-6,8-dienyl]-(cyclohexa-1,5-dien-1-ylmethyl)amino]ethyl]thiohydroxylamine (PubChem CID 144921266) has the molecular formula C22H34N2S and a molecular weight of 358.60 g/mol. Its IUPAC name is N-[2-[[(6Z)-2,6-bis(ethenyl)nona-6,8-dienyl]-(cyclohexa-1,5-dien-1-ylmethyl)amino]ethyl]thiohydroxylamine.
| Compound Name | N-[2-[[(6Z)-2,6-bis(ethenyl)nona-6,8-dienyl]-(cyclohexa-1,5-dien-1-ylmethyl)amino]ethyl]thiohydroxylamine |
|---|---|
| PubChem CID | 144921266 |
| Molecular Formula | C22H34N2S |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-[2-[[(6Z)-2,6-bis(ethenyl)nona-6,8-dienyl]-(cyclohexa-1,5-dien-1-ylmethyl)amino]ethyl]thiohydroxylamine |
| SMILES | C=C/C=C(\C=C)CCCC(C=C)CN(CCNS)CC1=CCCC=C1 |
| InChI | InChI=1S/C22H34N2S/c1-4-11-20(5-2)14-10-15-21(6-3)18-24(17-16-23-25)19-22-12-8-7-9-13-22/h4-6,8,11-13,21,23,25H,1-3,7,9-10,14-19H2/b20-11+ |
| InChIKey | VDIRKHSIKVQNEE-RGVLZGJSSA-N |
| XLogP | 5.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|