C20H23N — CID 143436432
(2E)-N-[(2-cyclohexa-1,5-dien-1-ylphenyl)methyl]-2-ethenylpenta-2,4-dien-1-amine (PubChem CID 143436432) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is (2E)-N-[(2-cyclohexa-1,5-dien-1-ylphenyl)methyl]-2-ethenylpenta-2,4-dien-1-amine.
| Compound Name | (2E)-N-[(2-cyclohexa-1,5-dien-1-ylphenyl)methyl]-2-ethenylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143436432 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (2E)-N-[(2-cyclohexa-1,5-dien-1-ylphenyl)methyl]-2-ethenylpenta-2,4-dien-1-amine |
| SMILES | C=C/C=C(\C=C)CNCc1ccccc1C1=CCCC=C1 |
| InChI | InChI=1S/C20H23N/c1-3-10-17(4-2)15-21-16-19-13-8-9-14-20(19)18-11-6-5-7-12-18/h3-4,6,8-14,21H,1-2,5,7,15-16H2/b17-10+ |
| InChIKey | MKPNDKLZVCJIDO-LICLKQGHSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|