C32H34N2 — CID 145276435
6-cyclohexa-1,5-dien-1-yl-4-(9,9-dimethylfluoren-2-yl)-2-[(3E)-hepta-1,3-dien-4-yl]-1,4-dihydropyrimidine (PubChem CID 145276435) has the molecular formula C32H34N2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 6-cyclohexa-1,5-dien-1-yl-4-(9,9-dimethylfluoren-2-yl)-2-[(3E)-hepta-1,3-dien-4-yl]-1,4-dihydropyrimidine.
| Compound Name | 6-cyclohexa-1,5-dien-1-yl-4-(9,9-dimethylfluoren-2-yl)-2-[(3E)-hepta-1,3-dien-4-yl]-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 145276435 |
| Molecular Formula | C32H34N2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 6-cyclohexa-1,5-dien-1-yl-4-(9,9-dimethylfluoren-2-yl)-2-[(3E)-hepta-1,3-dien-4-yl]-1,4-dihydropyrimidine |
| SMILES | C=C/C=C(\CCC)C1=NC(c2ccc3c(c2)C(C)(C)c2ccccc2-3)C=C(C2=CCCC=C2)N1 |
| InChI | InChI=1S/C32H34N2/c1-5-12-23(13-6-2)31-33-29(22-14-8-7-9-15-22)21-30(34-31)24-18-19-26-25-16-10-11-17-27(25)32(3,4)28(26)20-24/h5,8,10-12,14-21,30H,1,6-7,9,13H2,2-4H3,(H,33,34)/b23-12+ |
| InChIKey | HDUBDJBPVQRHQB-FSJBWODESA-N |
| XLogP | 8.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|