C42H34N4 — CID 156555998
4-[3-[6-cyclohexa-1,5-dien-1-yl-2-(4-phenylphenyl)-1,4-dihydropyrimidin-4-yl]phenyl]-2-ethyl-1,10-phenanthroline (PubChem CID 156555998) has the molecular formula C42H34N4 and a molecular weight of 594.76 g/mol. Its IUPAC name is 4-[3-[6-cyclohexa-1,5-dien-1-yl-2-(4-phenylphenyl)-1,4-dihydropyrimidin-4-yl]phenyl]-2-ethyl-1,10-phenanthroline.
| Compound Name | 4-[3-[6-cyclohexa-1,5-dien-1-yl-2-(4-phenylphenyl)-1,4-dihydropyrimidin-4-yl]phenyl]-2-ethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 156555998 |
| Molecular Formula | C42H34N4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 4-[3-[6-cyclohexa-1,5-dien-1-yl-2-(4-phenylphenyl)-1,4-dihydropyrimidin-4-yl]phenyl]-2-ethyl-1,10-phenanthroline |
| SMILES | CCc1cc(-c2cccc(C3C=C(C4=CCCC=C4)NC(c4ccc(-c5ccccc5)cc4)=N3)c2)c2ccc3cccnc3c2n1 |
| InChI | InChI=1S/C42H34N4/c1-2-35-26-37(36-23-22-31-17-10-24-43-40(31)41(36)44-35)33-15-9-16-34(25-33)39-27-38(30-13-7-4-8-14-30)45-42(46-39)32-20-18-29(19-21-32)28-11-5-3-6-12-28/h3,5-7,9-27,39H,2,4,8H2,1H3,(H,45,46) |
| InChIKey | CNRLZLKLPFBSBN-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|