C51H40N6 — CID 145390184
N'-(4,6-diphenylpyrimidin-2-yl)-1-[4-[3-[2-phenyl-6-(4-phenylphenyl)-1,4-dihydropyrimidin-4-yl]phenyl]phenyl]methanediamine (PubChem CID 145390184) has the molecular formula C51H40N6 and a molecular weight of 736.92 g/mol. Its IUPAC name is N'-(4,6-diphenylpyrimidin-2-yl)-1-[4-[3-[2-phenyl-6-(4-phenylphenyl)-1,4-dihydropyrimidin-4-yl]phenyl]phenyl]methanediamine.
| Compound Name | N'-(4,6-diphenylpyrimidin-2-yl)-1-[4-[3-[2-phenyl-6-(4-phenylphenyl)-1,4-dihydropyrimidin-4-yl]phenyl]phenyl]methanediamine |
|---|---|
| PubChem CID | 145390184 |
| Molecular Formula | C51H40N6 |
| Molecular Weight | 736.92 g/mol |
| Exact Mass | 736.33 |
| IUPAC Name | N'-(4,6-diphenylpyrimidin-2-yl)-1-[4-[3-[2-phenyl-6-(4-phenylphenyl)-1,4-dihydropyrimidin-4-yl]phenyl]phenyl]methanediamine |
| SMILES | NC(Nc1nc(-c2ccccc2)cc(-c2ccccc2)n1)c1ccc(-c2cccc(C3C=C(c4ccc(-c5ccccc5)cc4)NC(c4ccccc4)=N3)c2)cc1 |
| InChI | InChI=1S/C51H40N6/c52-49(57-51-55-46(38-16-7-2-8-17-38)34-47(56-51)39-18-9-3-10-19-39)41-30-26-37(27-31-41)43-22-13-23-44(32-43)48-33-45(53-50(54-48)42-20-11-4-12-21-42)40-28-24-36(25-29-40)35-14-5-1-6-15-35/h1-34,48-49H,52H2,(H,53,54)(H,55,56,57) |
| InChIKey | WPVQXTNQIVITFM-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.92 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|