C37H31N6- — CID 145390222
N'-(4,6-diphenyl-1,4-dihydropyrimidin-2-yl)-1-[4-(4-phenyl-4H-quinazolin-3-id-2-yl)phenyl]methanediamine (PubChem CID 145390222) has the molecular formula C37H31N6- and a molecular weight of 559.70 g/mol. Its IUPAC name is N'-(4,6-diphenyl-1,4-dihydropyrimidin-2-yl)-1-[4-(4-phenyl-4H-quinazolin-3-id-2-yl)phenyl]methanediamine.
| Compound Name | N'-(4,6-diphenyl-1,4-dihydropyrimidin-2-yl)-1-[4-(4-phenyl-4H-quinazolin-3-id-2-yl)phenyl]methanediamine |
|---|---|
| PubChem CID | 145390222 |
| Molecular Formula | C37H31N6- |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | N'-(4,6-diphenyl-1,4-dihydropyrimidin-2-yl)-1-[4-(4-phenyl-4H-quinazolin-3-id-2-yl)phenyl]methanediamine |
| SMILES | NC(NC1=NC(c2ccccc2)C=C(c2ccccc2)N1)c1ccc(C2=Nc3ccccc3C(c3ccccc3)[N-]2)cc1 |
| InChI | InChI=1S/C37H31N6/c38-35(43-37-40-32(25-12-4-1-5-13-25)24-33(41-37)26-14-6-2-7-15-26)28-20-22-29(23-21-28)36-39-31-19-11-10-18-30(31)34(42-36)27-16-8-3-9-17-27/h1-24,32,34-35H,38H2,(H2-,39,40,41,42,43)/q-1 |
| InChIKey | KHYUODRVLRWGDW-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|