C37H29N3S — CID 145303177
9-(6-cyclohexa-1,5-dien-1-yl-4-phenyl-1,4-dihydropyrimidin-2-yl)-2-phenyl-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole (PubChem CID 145303177) has the molecular formula C37H29N3S and a molecular weight of 547.73 g/mol. Its IUPAC name is 9-(6-cyclohexa-1,5-dien-1-yl-4-phenyl-1,4-dihydropyrimidin-2-yl)-2-phenyl-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole.
| Compound Name | 9-(6-cyclohexa-1,5-dien-1-yl-4-phenyl-1,4-dihydropyrimidin-2-yl)-2-phenyl-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 145303177 |
| Molecular Formula | C37H29N3S |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 9-(6-cyclohexa-1,5-dien-1-yl-4-phenyl-1,4-dihydropyrimidin-2-yl)-2-phenyl-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole |
| SMILES | C1=CC(C2=CC(c3ccccc3)N=C(c3ccc4c(ccc5ccc6c(c54)NC(c4ccccc4)S6)c3)N2)=CCC1 |
| InChI | InChI=1S/C37H29N3S/c1-4-10-24(11-5-1)31-23-32(25-12-6-2-7-13-25)39-36(38-31)29-18-20-30-28(22-29)17-16-26-19-21-33-35(34(26)30)40-37(41-33)27-14-8-3-9-15-27/h1,3-6,8-23,31,37,40H,2,7H2,(H,38,39) |
| InChIKey | PZJWLZUSSXKSAS-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|