C42H34N4S — CID 126614553
2-phenyl-9-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazinan-2-yl]-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole (PubChem CID 126614553) has the molecular formula C42H34N4S and a molecular weight of 626.83 g/mol. Its IUPAC name is 2-phenyl-9-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazinan-2-yl]-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole.
| Compound Name | 2-phenyl-9-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazinan-2-yl]-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 126614553 |
| Molecular Formula | C42H34N4S |
| Molecular Weight | 626.83 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 2-phenyl-9-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazinan-2-yl]-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole |
| SMILES | c1ccc(-c2cccc(C3NC(c4ccccc4)NC(c4ccc5c(ccc6ccc7c(c65)NC(c5ccccc5)S7)c4)N3)c2)cc1 |
| InChI | InChI=1S/C42H34N4S/c1-4-11-27(12-5-1)31-17-10-18-33(25-31)40-44-39(29-13-6-2-7-14-29)45-41(46-40)34-21-23-35-32(26-34)20-19-28-22-24-36-38(37(28)35)43-42(47-36)30-15-8-3-9-16-30/h1-26,39-46H |
| InChIKey | ZBRQLXSEVSWUNS-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.83 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|