C40H26N4S — CID 126614561
9-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-naphthalen-2-yl-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole (PubChem CID 126614561) has the molecular formula C40H26N4S and a molecular weight of 594.74 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-naphthalen-2-yl-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole.
| Compound Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-naphthalen-2-yl-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 126614561 |
| Molecular Formula | C40H26N4S |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-naphthalen-2-yl-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(ccc5ccc6c(c54)NC(c4ccc5ccccc5c4)S6)c3)n2)cc1 |
| InChI | InChI=1S/C40H26N4S/c1-3-10-27(11-4-1)37-42-38(28-12-5-2-6-13-28)44-39(43-37)31-19-21-33-30(24-31)17-16-26-20-22-34-36(35(26)33)41-40(45-34)32-18-15-25-9-7-8-14-29(25)23-32/h1-24,40-41H |
| InChIKey | MIFYQKLNWPMDCK-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|