C37H27N3S — CID 155108526
2-cyclohexa-2,4-dien-1-yl-9-(4,6-diphenylpyrimidin-2-yl)-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole (PubChem CID 155108526) has the molecular formula C37H27N3S and a molecular weight of 545.71 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-9-(4,6-diphenylpyrimidin-2-yl)-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-9-(4,6-diphenylpyrimidin-2-yl)-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 155108526 |
| Molecular Formula | C37H27N3S |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-9-(4,6-diphenylpyrimidin-2-yl)-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole |
| SMILES | C1=CCC(C2Nc3c(ccc4ccc5cc(-c6nc(-c7ccccc7)cc(-c7ccccc7)n6)ccc5c34)S2)C=C1 |
| InChI | InChI=1S/C37H27N3S/c1-4-10-24(11-5-1)31-23-32(25-12-6-2-7-13-25)39-36(38-31)29-18-20-30-28(22-29)17-16-26-19-21-33-35(34(26)30)40-37(41-33)27-14-8-3-9-15-27/h1-14,16-23,27,37,40H,15H2 |
| InChIKey | RVYYEKIHDIDHHO-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|