C43H31N3O — CID 167045792
2-cyclohexa-1,5-dien-1-yl-9-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-1,2-dihydronaphtho[1,2-e][1,3]benzoxazole (PubChem CID 167045792) has the molecular formula C43H31N3O and a molecular weight of 605.74 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-9-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-1,2-dihydronaphtho[1,2-e][1,3]benzoxazole.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-9-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-1,2-dihydronaphtho[1,2-e][1,3]benzoxazole |
|---|---|
| PubChem CID | 167045792 |
| Molecular Formula | C43H31N3O |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-9-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-1,2-dihydronaphtho[1,2-e][1,3]benzoxazole |
| SMILES | C1=CC(C2Nc3c(ccc4ccc5cc(-c6cccc(-c7nc(-c8ccccc8)cc(-c8ccccc8)n7)c6)ccc5c34)O2)=CCC1 |
| InChI | InChI=1S/C43H31N3O/c1-4-11-28(12-5-1)37-27-38(29-13-6-2-7-14-29)45-42(44-37)35-18-10-17-32(26-35)33-21-23-36-34(25-33)20-19-30-22-24-39-41(40(30)36)46-43(47-39)31-15-8-3-9-16-31/h1-2,4-8,10-27,43,46H,3,9H2 |
| InChIKey | XTBFXQGVULXQEL-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|