C37H27N3O — CID 167045940
2-cyclohexa-2,4-dien-1-yl-10-(4,6-diphenylpyrimidin-2-yl)-1,2-dihydronaphtho[1,2-e][1,3]benzoxazole (PubChem CID 167045940) has the molecular formula C37H27N3O and a molecular weight of 529.64 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-10-(4,6-diphenylpyrimidin-2-yl)-1,2-dihydronaphtho[1,2-e][1,3]benzoxazole.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-10-(4,6-diphenylpyrimidin-2-yl)-1,2-dihydronaphtho[1,2-e][1,3]benzoxazole |
|---|---|
| PubChem CID | 167045940 |
| Molecular Formula | C37H27N3O |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-10-(4,6-diphenylpyrimidin-2-yl)-1,2-dihydronaphtho[1,2-e][1,3]benzoxazole |
| SMILES | C1=CCC(C2Nc3c(ccc4ccc5ccc(-c6nc(-c7ccccc7)cc(-c7ccccc7)n6)cc5c34)O2)C=C1 |
| InChI | InChI=1S/C37H27N3O/c1-4-10-25(11-5-1)31-23-32(26-12-6-2-7-13-26)39-36(38-31)29-19-17-24-16-18-27-20-21-33-35(34(27)30(24)22-29)40-37(41-33)28-14-8-3-9-15-28/h1-14,16-23,28,37,40H,15H2 |
| InChIKey | LZVCRKPFHAAOQF-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|