C42H32N4S — CID 167045818
2-cyclohexa-2,4-dien-1-yl-9-[2-phenyl-6-(4-phenylphenyl)-1,4-dihydro-1,3,5-triazin-4-yl]-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole (PubChem CID 167045818) has the molecular formula C42H32N4S and a molecular weight of 624.81 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-9-[2-phenyl-6-(4-phenylphenyl)-1,4-dihydro-1,3,5-triazin-4-yl]-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-9-[2-phenyl-6-(4-phenylphenyl)-1,4-dihydro-1,3,5-triazin-4-yl]-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 167045818 |
| Molecular Formula | C42H32N4S |
| Molecular Weight | 624.81 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-9-[2-phenyl-6-(4-phenylphenyl)-1,4-dihydro-1,3,5-triazin-4-yl]-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole |
| SMILES | C1=CCC(C2Nc3c(ccc4ccc5cc(C6N=C(c7ccccc7)NC(c7ccc(-c8ccccc8)cc7)=N6)ccc5c34)S2)C=C1 |
| InChI | InChI=1S/C42H32N4S/c1-4-10-27(11-5-1)28-16-19-31(20-17-28)40-44-39(30-12-6-2-7-13-30)45-41(46-40)34-22-24-35-33(26-34)21-18-29-23-25-36-38(37(29)35)43-42(47-36)32-14-8-3-9-15-32/h1-14,16-26,32,41-43H,15H2,(H,44,45,46) |
| InChIKey | VLSAPDMRHATPCO-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.81 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|