C36H26N4S — CID 167045946
2-cyclohexa-2,4-dien-1-yl-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole (PubChem CID 167045946) has the molecular formula C36H26N4S and a molecular weight of 546.70 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 167045946 |
| Molecular Formula | C36H26N4S |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,2-dihydronaphtho[1,2-e][1,3]benzothiazole |
| SMILES | C1=CCC(C2Nc3c(ccc4ccc5cc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)ccc5c34)S2)C=C1 |
| InChI | InChI=1S/C36H26N4S/c1-4-10-24(11-5-1)33-38-34(25-12-6-2-7-13-25)40-35(39-33)28-18-20-29-27(22-28)17-16-23-19-21-30-32(31(23)29)37-36(41-30)26-14-8-3-9-15-26/h1-14,16-22,26,36-37H,15H2 |
| InChIKey | CAVAAHLLOKLKPZ-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|