C47H34N2O — CID 146388549
4-cyclohexa-2,4-dien-1-yl-2-[4-(9,9-diphenylxanthen-2-yl)phenyl]-6-phenylpyrimidine (PubChem CID 146388549) has the molecular formula C47H34N2O and a molecular weight of 642.80 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-yl-2-[4-(9,9-diphenylxanthen-2-yl)phenyl]-6-phenylpyrimidine.
| Compound Name | 4-cyclohexa-2,4-dien-1-yl-2-[4-(9,9-diphenylxanthen-2-yl)phenyl]-6-phenylpyrimidine |
|---|---|
| PubChem CID | 146388549 |
| Molecular Formula | C47H34N2O |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-yl-2-[4-(9,9-diphenylxanthen-2-yl)phenyl]-6-phenylpyrimidine |
| SMILES | C1=CCC(c2cc(-c3ccccc3)nc(-c3ccc(-c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4ccccc4O5)cc3)n2)C=C1 |
| InChI | InChI=1S/C47H34N2O/c1-5-15-34(16-6-1)42-32-43(35-17-7-2-8-18-35)49-46(48-42)36-27-25-33(26-28-36)37-29-30-45-41(31-37)47(38-19-9-3-10-20-38,39-21-11-4-12-22-39)40-23-13-14-24-44(40)50-45/h1-17,19-32,35H,18H2 |
| InChIKey | IGOYSCHBUFEEAL-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |