C48H31N3O — CID 166031323
2-[3-(9,9-diphenylxanthen-2-yl)phenyl]-4-(4-isocyanophenyl)-6-phenylpyrimidine (PubChem CID 166031323) has the molecular formula C48H31N3O and a molecular weight of 665.80 g/mol. Its IUPAC name is 2-[3-(9,9-diphenylxanthen-2-yl)phenyl]-4-(4-isocyanophenyl)-6-phenylpyrimidine.
| Compound Name | 2-[3-(9,9-diphenylxanthen-2-yl)phenyl]-4-(4-isocyanophenyl)-6-phenylpyrimidine |
|---|---|
| PubChem CID | 166031323 |
| Molecular Formula | C48H31N3O |
| Molecular Weight | 665.80 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | 2-[3-(9,9-diphenylxanthen-2-yl)phenyl]-4-(4-isocyanophenyl)-6-phenylpyrimidine |
| SMILES | [C-]#[N+]c1ccc(-c2cc(-c3ccccc3)nc(-c3cccc(-c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4ccccc4O5)c3)n2)cc1 |
| InChI | InChI=1S/C48H31N3O/c1-49-40-27-24-34(25-28-40)44-32-43(33-14-5-2-6-15-33)50-47(51-44)37-17-13-16-35(30-37)36-26-29-46-42(31-36)48(38-18-7-3-8-19-38,39-20-9-4-10-21-39)41-22-11-12-23-45(41)52-46/h2-32H |
| InChIKey | VKCDOEYNIYGCHK-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 39.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.80 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|