C42H27N3O — CID 166031495
4-[2-(9,9-diphenylxanthen-2-yl)-6-phenylpyrimidin-4-yl]benzonitrile (PubChem CID 166031495) has the molecular formula C42H27N3O and a molecular weight of 589.70 g/mol. Its IUPAC name is 4-[2-(9,9-diphenylxanthen-2-yl)-6-phenylpyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[2-(9,9-diphenylxanthen-2-yl)-6-phenylpyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 166031495 |
| Molecular Formula | C42H27N3O |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | 4-[2-(9,9-diphenylxanthen-2-yl)-6-phenylpyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3ccccc3)nc(-c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3O4)n2)cc1 |
| InChI | InChI=1S/C42H27N3O/c43-28-29-20-22-31(23-21-29)38-27-37(30-12-4-1-5-13-30)44-41(45-38)32-24-25-40-36(26-32)42(33-14-6-2-7-15-33,34-16-8-3-9-17-34)35-18-10-11-19-39(35)46-40/h1-27H |
| InChIKey | SEYWWSPPKXJIEK-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |