C53H34N4O — CID 163439529
4-[4-[4-(9,9-diphenylxanthen-2-yl)-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 163439529) has the molecular formula C53H34N4O and a molecular weight of 742.88 g/mol. Its IUPAC name is 4-[4-[4-(9,9-diphenylxanthen-2-yl)-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[4-(9,9-diphenylxanthen-2-yl)-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 163439529 |
| Molecular Formula | C53H34N4O |
| Molecular Weight | 742.88 g/mol |
| Exact Mass | 742.27 |
| IUPAC Name | 4-[4-[4-(9,9-diphenylxanthen-2-yl)-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3nc(-c4cccc(-c5ccccc5)c4)nc(-c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4ccccc4O5)n3)cc2)cc1 |
| InChI | InChI=1S/C53H34N4O/c54-35-36-23-25-38(26-24-36)39-27-29-40(30-28-39)50-55-51(42-16-12-15-41(33-42)37-13-4-1-5-14-37)57-52(56-50)43-31-32-49-47(34-43)53(44-17-6-2-7-18-44,45-19-8-3-9-20-45)46-21-10-11-22-48(46)58-49/h1-34H |
| InChIKey | AXIILKJAFRVZOH-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.88 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |