C37H31N3S — CID 167045794
2-cyclohexa-2,4-dien-1-yl-8-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-1,2,7a,11a-tetrahydronaphtho[1,2-e][1,3]benzothiazole (PubChem CID 167045794) has the molecular formula C37H31N3S and a molecular weight of 549.74 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-8-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-1,2,7a,11a-tetrahydronaphtho[1,2-e][1,3]benzothiazole.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-8-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-1,2,7a,11a-tetrahydronaphtho[1,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 167045794 |
| Molecular Formula | C37H31N3S |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-8-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-1,2,7a,11a-tetrahydronaphtho[1,2-e][1,3]benzothiazole |
| SMILES | C1=CCC(C2Nc3c(ccc4c3C3C=CC=C(C5N=C(c6ccccc6)C=C(c6ccccc6)N5)C3C=C4)S2)C=C1 |
| InChI | InChI=1S/C37H31N3S/c1-4-11-24(12-5-1)31-23-32(25-13-6-2-7-14-25)39-36(38-31)30-18-10-17-29-28(30)21-19-26-20-22-33-35(34(26)29)40-37(41-33)27-15-8-3-9-16-27/h1-15,17-23,27-29,36-38,40H,16H2 |
| InChIKey | BHSSAXNAWOJYTB-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |