C48H40 — CID 172627543
1-cyclohexa-1,5-dien-1-yl-2-[4-[3-cyclohexa-1,5-dien-1-yl-2-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]phenyl]-3,4-diphenylbenzene (PubChem CID 172627543) has the molecular formula C48H40 and a molecular weight of 616.85 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-[4-[3-cyclohexa-1,5-dien-1-yl-2-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]phenyl]-3,4-diphenylbenzene.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-[4-[3-cyclohexa-1,5-dien-1-yl-2-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]phenyl]-3,4-diphenylbenzene |
|---|---|
| PubChem CID | 172627543 |
| Molecular Formula | C48H40 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-[4-[3-cyclohexa-1,5-dien-1-yl-2-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]phenyl]-3,4-diphenylbenzene |
| SMILES | C=C/C=C(\C=C)c1c(C2=CCCC=C2)cccc1-c1ccc(-c2c(C3=CCCC=C3)ccc(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C48H40/c1-3-18-35(4-2)46-42(36-19-9-5-10-20-36)27-17-28-43(46)39-29-31-41(32-30-39)48-45(38-23-13-7-14-24-38)34-33-44(37-21-11-6-12-22-37)47(48)40-25-15-8-16-26-40/h3-4,6,8-9,11-13,15-34H,1-2,5,7,10,14H2/b35-18+ |
| InChIKey | SDQSQUPSCFYBJY-MWBNBJEGSA-N |
| XLogP | 13.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|