C40H32 — CID 145376392
8-cyclohexa-1,5-dien-1-yl-7-[(2E,4Z)-hexa-2,4-dien-3-yl]-9,10-diphenylfluoranthene (PubChem CID 145376392) has the molecular formula C40H32 and a molecular weight of 512.70 g/mol. Its IUPAC name is 8-cyclohexa-1,5-dien-1-yl-7-[(2E,4Z)-hexa-2,4-dien-3-yl]-9,10-diphenylfluoranthene.
| Compound Name | 8-cyclohexa-1,5-dien-1-yl-7-[(2E,4Z)-hexa-2,4-dien-3-yl]-9,10-diphenylfluoranthene |
|---|---|
| PubChem CID | 145376392 |
| Molecular Formula | C40H32 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 8-cyclohexa-1,5-dien-1-yl-7-[(2E,4Z)-hexa-2,4-dien-3-yl]-9,10-diphenylfluoranthene |
| SMILES | C/C=C\C(=C/C)c1c(C2=CCCC=C2)c(-c2ccccc2)c(-c2ccccc2)c2c1-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C40H32/c1-3-16-27(4-2)35-36(29-17-8-5-9-18-29)37(30-19-10-6-11-20-30)38(31-21-12-7-13-22-31)40-33-26-15-24-28-23-14-25-32(34(28)33)39(35)40/h3-4,6-8,10-26H,5,9H2,1-2H3/b16-3-,27-4+ |
| InChIKey | KDMBCQSUJQVCRS-NCASPDNCSA-N |
| XLogP | 11.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|