C82H64O4 — CID 142382583
1-[4-[3,4-bis(4-methoxyphenyl)-2,5,6-triphenylphenyl]phenyl]-3-cyclohexa-1,5-dien-1-yl-4,5-bis(4-methoxyphenyl)-2,6-diphenylbenzene (PubChem CID 142382583) has the molecular formula C82H64O4 and a molecular weight of 1113.41 g/mol. Its IUPAC name is 1-[4-[3,4-bis(4-methoxyphenyl)-2,5,6-triphenylphenyl]phenyl]-3-cyclohexa-1,5-dien-1-yl-4,5-bis(4-methoxyphenyl)-2,6-diphenylbenzene.
| Compound Name | 1-[4-[3,4-bis(4-methoxyphenyl)-2,5,6-triphenylphenyl]phenyl]-3-cyclohexa-1,5-dien-1-yl-4,5-bis(4-methoxyphenyl)-2,6-diphenylbenzene |
|---|---|
| PubChem CID | 142382583 |
| Molecular Formula | C82H64O4 |
| Molecular Weight | 1113.41 g/mol |
| Exact Mass | 1112.48 |
| IUPAC Name | 1-[4-[3,4-bis(4-methoxyphenyl)-2,5,6-triphenylphenyl]phenyl]-3-cyclohexa-1,5-dien-1-yl-4,5-bis(4-methoxyphenyl)-2,6-diphenylbenzene |
| SMILES | COc1ccc(-c2c(C3=CCCC=C3)c(-c3ccccc3)c(-c3ccc(-c4c(-c5ccccc5)c(-c5ccccc5)c(-c5ccc(OC)cc5)c(-c5ccc(OC)cc5)c4-c4ccccc4)cc3)c(-c3ccccc3)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C82H64O4/c1-83-67-47-39-63(40-48-67)79-73(57-27-15-7-16-28-57)71(55-23-11-5-12-24-55)77(75(59-31-19-9-20-32-59)81(79)65-43-51-69(85-3)52-44-65)61-35-37-62(38-36-61)78-72(56-25-13-6-14-26-56)74(58-29-17-8-18-30-58)80(64-41-49-68(84-2)50-42-64)82(66-45-53-70(86-4)54-46-66)76(78)60-33-21-10-22-34-60/h5-7,9-17,19-54H,8,18H2,1-4H3 |
| InChIKey | HQGIOYYEBWBHCL-UHFFFAOYSA-N |
| XLogP | 21.79 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1113.41 |
| LogP ≤ 5 | 21.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |