C18H20 — CID 144938588
2-cyclohexa-1,5-dien-1-ylnaphthalene;ethane (PubChem CID 144938588) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-ylnaphthalene;ethane.
| Compound Name | 2-cyclohexa-1,5-dien-1-ylnaphthalene;ethane |
|---|---|
| PubChem CID | 144938588 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-ylnaphthalene;ethane |
| SMILES | C1=CC(c2ccc3ccccc3c2)=CCC1.CC |
| InChI | InChI=1S/C16H14.C2H6/c1-2-6-13(7-3-1)16-11-10-14-8-4-5-9-15(14)12-16;1-2/h2,4-12H,1,3H2;1-2H3 |
| InChIKey | LAKSYVMGNQTRSJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |