C15H12O2 — CID 90031317
6-cyclohexa-1,5-dien-1-ylisochromen-1-one (PubChem CID 90031317) has the molecular formula C15H12O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 6-cyclohexa-1,5-dien-1-ylisochromen-1-one.
| Compound Name | 6-cyclohexa-1,5-dien-1-ylisochromen-1-one |
|---|---|
| PubChem CID | 90031317 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 6-cyclohexa-1,5-dien-1-ylisochromen-1-one |
| SMILES | O=c1occc2cc(C3=CCCC=C3)ccc12 |
| InChI | InChI=1S/C15H12O2/c16-15-14-7-6-12(10-13(14)8-9-17-15)11-4-2-1-3-5-11/h2,4-10H,1,3H2 |
| InChIKey | SKDMJXRWCLSZMF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |