C10H6O4 — CID 15120993
[1,3]dioxolo[4,5-g]isochromen-5-one (PubChem CID 15120993) has the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. Its IUPAC name is [1,3]dioxolo[4,5-g]isochromen-5-one.
| Compound Name | [1,3]dioxolo[4,5-g]isochromen-5-one |
|---|---|
| PubChem CID | 15120993 |
| Molecular Formula | C10H6O4 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | [1,3]dioxolo[4,5-g]isochromen-5-one |
| SMILES | O=c1occc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C10H6O4/c11-10-7-4-9-8(13-5-14-9)3-6(7)1-2-12-10/h1-4H,5H2 |
| InChIKey | XABFPUSPEDZCMC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |