About methyl 3,4-dimethoxybenzoate
methyl 3,4-dimethoxybenzoate (PubChem CID 16522) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is methyl 3,4-dimethoxybenzoate.
Molecular Properties
| Compound Name | methyl 3,4-dimethoxybenzoate |
| PubChem CID | 16522 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | methyl 3,4-dimethoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C10H12O4/c1-12-8-5-4-7(10(11)14-3)6-9(8)13-2/h4-6H,1-3H3 |
| InChIKey | BIGQPYZPEWAPBG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3,4-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3,4-dimethoxybenzoate?
The IUPAC name of methyl 3,4-dimethoxybenzoate (CID 16522) is methyl 3,4-dimethoxybenzoate.
What is the SMILES notation for methyl 3,4-dimethoxybenzoate?
The canonical SMILES for methyl 3,4-dimethoxybenzoate is COC(=O)c1ccc(OC)c(OC)c1.
What is the InChIKey of methyl 3,4-dimethoxybenzoate?
The InChIKey is BIGQPYZPEWAPBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-12-8-5-4-7(10(11)14-3)6-9(8)13-2/h4-6H,1-3H3.
What are the key properties of methyl 3,4-dimethoxybenzoate?
methyl 3,4-dimethoxybenzoate has a molecular weight of 196.20 g/mol, XLogP of 1.49, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,4-dimethoxybenzoate is sourced from PubChem (CID 16522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).