About 7-methoxy-1,3-benzodioxole-5-carboxylic acid
7-methoxy-1,3-benzodioxole-5-carboxylic acid (PubChem CID 607309) has the molecular formula C9H8O5
and a molecular weight of 196.16 g/mol. Its IUPAC name is 7-methoxy-1,3-benzodioxole-5-carboxylic acid.
Molecular Properties
| Compound Name | 7-methoxy-1,3-benzodioxole-5-carboxylic acid |
| PubChem CID | 607309 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 7-methoxy-1,3-benzodioxole-5-carboxylic acid |
| SMILES | COc1cc(C(=O)O)cc2c1OCO2 |
| InChI | InChI=1S/C9H8O5/c1-12-6-2-5(9(10)11)3-7-8(6)14-4-13-7/h2-3H,4H2,1H3,(H,10,11) |
| InChIKey | AOHAPDDBNAPPIN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methoxy-1,3-benzodioxole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-1,3-benzodioxole-5-carboxylic acid?
The IUPAC name of 7-methoxy-1,3-benzodioxole-5-carboxylic acid (CID 607309) is 7-methoxy-1,3-benzodioxole-5-carboxylic acid.
What is the SMILES notation for 7-methoxy-1,3-benzodioxole-5-carboxylic acid?
The canonical SMILES for 7-methoxy-1,3-benzodioxole-5-carboxylic acid is COc1cc(C(=O)O)cc2c1OCO2.
What is the InChIKey of 7-methoxy-1,3-benzodioxole-5-carboxylic acid?
The InChIKey is AOHAPDDBNAPPIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O5/c1-12-6-2-5(9(10)11)3-7-8(6)14-4-13-7/h2-3H,4H2,1H3,(H,10,11).
What are the key properties of 7-methoxy-1,3-benzodioxole-5-carboxylic acid?
7-methoxy-1,3-benzodioxole-5-carboxylic acid has a molecular weight of 196.16 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-1,3-benzodioxole-5-carboxylic acid is sourced from PubChem (CID 607309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).